Salts and Inorganics
A variety of inorganic salts and elemental metals that can be used for large-scale, industrial purposes and everyday laboratory applications. Products are available in a range of chemical compositions, quantities, purities, and reagent grades.
Inorganics are elements and compounds, including carbon monoxide, carbon dioxide, carbonates, cyanides, cyanates, and carbides, that do not contain a carbon-hydrogen bond. This group also includes carbon allotropes such as graphite and graphene.
Because organic chemicals include only those that contain carbon atoms bonded to hydrogen atoms, the majority of elements in the periodic table and most substances in the material world are considered to be inorganic chemicals.
Filtered Search Results
Thermo Scientific™ Potassium, Ion chromatography standard solution, Specpure™, K++ 1000μg/ml
Molecular Formula: KNO{3} in H{2}O
| Molecular Formula | KNO{3} in H{2}O |
|---|
Aluminum oxide, 99.99%, (trace metal basis), extra pure
CAS: 1344-28-1 Molecular Formula: Al2O3 Molecular Weight (g/mol): 101.96 MDL Number: MFCD00003424 InChI Key: PNEYBMLMFCGWSK-UHFFFAOYSA-N Synonym: aluminum oxide,aluminum oxide,alpha-alumina,fasertonerde,abramant,abramax,abrarex,abrasit,aloxite,alundum PubChem CID: 9989226 IUPAC Name: dialuminium(3+) trioxidandiide SMILES: [O--].[O--].[O--].[Al+3].[Al+3]
| PubChem CID | 9989226 |
|---|---|
| CAS | 1344-28-1 |
| Molecular Weight (g/mol) | 101.96 |
| MDL Number | MFCD00003424 |
| SMILES | [O--].[O--].[O--].[Al+3].[Al+3] |
| Synonym | aluminum oxide,aluminum oxide,alpha-alumina,fasertonerde,abramant,abramax,abrarex,abrasit,aloxite,alundum |
| IUPAC Name | dialuminium(3+) trioxidandiide |
| InChI Key | PNEYBMLMFCGWSK-UHFFFAOYSA-N |
| Molecular Formula | Al2O3 |
Cobalt(II) nitrate hexahydrate, 99+%, for analysis
CAS: 10026-22-9 Molecular Formula: CoH12N2O12 Molecular Weight (g/mol): 291.03 MDL Number: MFCD00149647 InChI Key: QGUAJWGNOXCYJF-UHFFFAOYSA-N Synonym: cobalt nitrate hexahydrate,cobalt ii nitrate hexahydrate,cobaltous nitrate hexahydrate,cobalt dinitrate hexahydrate,cobalt 2+ nitrate hexahydrate,cobaltous nitrate, hexahydrate,kobalt ii-nitrat-hexahydrat,nitric acid, cobalt 2+ salt, hexahydrate PubChem CID: 24821 ChEBI: CHEBI:86214 IUPAC Name: λ²-cobalt(2+) hexahydrate dinitrate SMILES: O.O.O.O.O.O.[Co++].[O-][N+]([O-])=O.[O-][N+]([O-])=O
| PubChem CID | 24821 |
|---|---|
| CAS | 10026-22-9 |
| Molecular Weight (g/mol) | 291.03 |
| ChEBI | CHEBI:86214 |
| MDL Number | MFCD00149647 |
| SMILES | O.O.O.O.O.O.[Co++].[O-][N+]([O-])=O.[O-][N+]([O-])=O |
| Synonym | cobalt nitrate hexahydrate,cobalt ii nitrate hexahydrate,cobaltous nitrate hexahydrate,cobalt dinitrate hexahydrate,cobalt 2+ nitrate hexahydrate,cobaltous nitrate, hexahydrate,kobalt ii-nitrat-hexahydrat,nitric acid, cobalt 2+ salt, hexahydrate |
| IUPAC Name | λ²-cobalt(2+) hexahydrate dinitrate |
| InChI Key | QGUAJWGNOXCYJF-UHFFFAOYSA-N |
| Molecular Formula | CoH12N2O12 |
Aluminum sec-butoxide, 97%
CAS: 2269-22-9 Molecular Formula: C12H30AlO3 Molecular Weight (g/mol): 249.351 MDL Number: MFCD00009327 InChI Key: LWGPRERTOLVRLK-UHFFFAOYSA-N Synonym: aluminum sec-butoxide,aluminum tri-sec-butoxide,2-butanol, aluminum salt,aluminum sec-butylate,aluminum butan-2-olate,aluminum tri-s-butoxide,2-butanol, aluminum salt 3:1,aluminum tri-sec-butanolate,al o-sec-bu 3,aluminiumtri-sec-butoxide PubChem CID: 50931103 IUPAC Name: aluminum;butan-2-ol SMILES: CCC(C)O.CCC(C)O.CCC(C)O.[Al]
| PubChem CID | 50931103 |
|---|---|
| CAS | 2269-22-9 |
| Molecular Weight (g/mol) | 249.351 |
| MDL Number | MFCD00009327 |
| SMILES | CCC(C)O.CCC(C)O.CCC(C)O.[Al] |
| Synonym | aluminum sec-butoxide,aluminum tri-sec-butoxide,2-butanol, aluminum salt,aluminum sec-butylate,aluminum butan-2-olate,aluminum tri-s-butoxide,2-butanol, aluminum salt 3:1,aluminum tri-sec-butanolate,al o-sec-bu 3,aluminiumtri-sec-butoxide |
| IUPAC Name | aluminum;butan-2-ol |
| InChI Key | LWGPRERTOLVRLK-UHFFFAOYSA-N |
| Molecular Formula | C12H30AlO3 |
Phosphonitrilic chloride trimer, 98%
CAS: 940-71-6 Molecular Formula: Cl6N3P3 Molecular Weight (g/mol): 347.65 MDL Number: MFCD00006474 InChI Key: UBIJTWDKTYCPMQ-UHFFFAOYSA-N Synonym: phosphonitrilic chloride trimer,hexachlorocyclotriphosphazene,hexachlorophosphazene,triphosphonitrilic chloride,triphosphonitrile chloride,hexachlorotriphosphonitrile,cyclophosphazene dichloride trimer,hexachlorocyclophosphazatriene,hexachlorocyclotriphosphazatriene,phosphononitrilic chloride trimer PubChem CID: 220225 IUPAC Name: 2,2,4,4,6,6-hexachloro-1,3,5-triaza-2$l^{5},4$l^{5},6$l^{5}-triphosphacyclohexa-1,3,5-triene SMILES: N1=P(N=P(N=P1(Cl)Cl)(Cl)Cl)(Cl)Cl
| PubChem CID | 220225 |
|---|---|
| CAS | 940-71-6 |
| Molecular Weight (g/mol) | 347.65 |
| MDL Number | MFCD00006474 |
| SMILES | N1=P(N=P(N=P1(Cl)Cl)(Cl)Cl)(Cl)Cl |
| Synonym | phosphonitrilic chloride trimer,hexachlorocyclotriphosphazene,hexachlorophosphazene,triphosphonitrilic chloride,triphosphonitrile chloride,hexachlorotriphosphonitrile,cyclophosphazene dichloride trimer,hexachlorocyclophosphazatriene,hexachlorocyclotriphosphazatriene,phosphononitrilic chloride trimer |
| IUPAC Name | 2,2,4,4,6,6-hexachloro-1,3,5-triaza-2$l^{5},4$l^{5},6$l^{5}-triphosphacyclohexa-1,3,5-triene |
| InChI Key | UBIJTWDKTYCPMQ-UHFFFAOYSA-N |
| Molecular Formula | Cl6N3P3 |
Gold slug, 6.35mm (0.25in) dia x 6.35mm (0.25in) length, Premion™, 99.999% (metals basis)
CAS: 7440-57-5 Molecular Formula: Au Molecular Weight (g/mol): 196.97 MDL Number: MFCD00003436 InChI Key: PCHJSUWPFVWCPO-UHFFFAOYSA-N Synonym: colloidal,powder,flake,leaf,gold, colloidal,burnish,shell,ci pigment metal 3,magnesium purple,c.i. pigment metal 3 PubChem CID: 23985 ChEBI: CHEBI:30050 IUPAC Name: gold SMILES: [Au]
| PubChem CID | 23985 |
|---|---|
| CAS | 7440-57-5 |
| Molecular Weight (g/mol) | 196.97 |
| ChEBI | CHEBI:30050 |
| MDL Number | MFCD00003436 |
| SMILES | [Au] |
| Synonym | colloidal,powder,flake,leaf,gold, colloidal,burnish,shell,ci pigment metal 3,magnesium purple,c.i. pigment metal 3 |
| IUPAC Name | gold |
| InChI Key | PCHJSUWPFVWCPO-UHFFFAOYSA-N |
| Molecular Formula | Au |
Cadmium oxide, 99%, pure
CAS: 1306-19-0 Molecular Formula: CdO Molecular Weight (g/mol): 128.41 MDL Number: MFCD00010921 InChI Key: CFEAAQFZALKQPA-UHFFFAOYSA-N Synonym: cadmium oxide,cadmium monoxide,cadmium fume,aska-rid,kadmu tlenek polish,caswell no. 136aa,ccris 115,epa pesticide chemical code 236200,dsstox_cid_4715 PubChem CID: 14782 IUPAC Name: oxocadmium SMILES: [O--].[Cd++]
| PubChem CID | 14782 |
|---|---|
| CAS | 1306-19-0 |
| Molecular Weight (g/mol) | 128.41 |
| MDL Number | MFCD00010921 |
| SMILES | [O--].[Cd++] |
| Synonym | cadmium oxide,cadmium monoxide,cadmium fume,aska-rid,kadmu tlenek polish,caswell no. 136aa,ccris 115,epa pesticide chemical code 236200,dsstox_cid_4715 |
| IUPAC Name | oxocadmium |
| InChI Key | CFEAAQFZALKQPA-UHFFFAOYSA-N |
| Molecular Formula | CdO |
Sodium, 30wt% dispersion in toluene, <0.1 mm particle size
CAS: 7440-23-5 Molecular Formula: Na Molecular Weight (g/mol): 22.99 MDL Number: MFCD00085307 InChI Key: KEAYESYHFKHZAL-UHFFFAOYSA-N Synonym: natrium,sodium-23,sodio,metal,sodio spanish,liquid alloy,unii-9nez333n27,hsdb 687,unii-23j3bhr95o,ingot PubChem CID: 5360545 ChEBI: CHEBI:26708 IUPAC Name: sodium SMILES: [Na]
| PubChem CID | 5360545 |
|---|---|
| CAS | 7440-23-5 |
| Molecular Weight (g/mol) | 22.99 |
| ChEBI | CHEBI:26708 |
| MDL Number | MFCD00085307 |
| SMILES | [Na] |
| Synonym | natrium,sodium-23,sodio,metal,sodio spanish,liquid alloy,unii-9nez333n27,hsdb 687,unii-23j3bhr95o,ingot |
| IUPAC Name | sodium |
| InChI Key | KEAYESYHFKHZAL-UHFFFAOYSA-N |
| Molecular Formula | Na |
Bismuth(III) Oxide, Extra Pure, MilliporeSigma™
CAS: 1304-76-3 Molecular Formula: Bi2O3 Molecular Weight (g/mol): 465.96 MDL Number: MFCD00003462 InChI Key: TYIXMATWDRGMPF-UHFFFAOYSA-N IUPAC Name: dibismuth(3+) trioxidandiide SMILES: [O--].[O--].[O--].[Bi+3].[Bi+3]
| CAS | 1304-76-3 |
|---|---|
| Molecular Weight (g/mol) | 465.96 |
| MDL Number | MFCD00003462 |
| SMILES | [O--].[O--].[O--].[Bi+3].[Bi+3] |
| IUPAC Name | dibismuth(3+) trioxidandiide |
| InChI Key | TYIXMATWDRGMPF-UHFFFAOYSA-N |
| Molecular Formula | Bi2O3 |
Sodium iodide, 99+%, pure, anhydrous
CAS: 7681-82-5 Molecular Formula: INa Molecular Weight (g/mol): 149.89 MDL Number: MFCD00003532 InChI Key: FVAUCKIRQBBSSJ-UHFFFAOYSA-M Synonym: sodium iodide,ioduril,sodium monoiodide,soiodin,sodiumiodide,natrii iodidum,jodid sodny,iodure de sodium,jodid sodny czech PubChem CID: 5238 ChEBI: CHEBI:33167 IUPAC Name: sodium;iodide SMILES: [Na+].[I-]
| PubChem CID | 5238 |
|---|---|
| CAS | 7681-82-5 |
| Molecular Weight (g/mol) | 149.89 |
| ChEBI | CHEBI:33167 |
| MDL Number | MFCD00003532 |
| SMILES | [Na+].[I-] |
| Synonym | sodium iodide,ioduril,sodium monoiodide,soiodin,sodiumiodide,natrii iodidum,jodid sodny,iodure de sodium,jodid sodny czech |
| IUPAC Name | sodium;iodide |
| InChI Key | FVAUCKIRQBBSSJ-UHFFFAOYSA-M |
| Molecular Formula | INa |
Lead(II) oxide, Puratronic™, 99.9995% (metals basis)
CAS: 1317-36-8 Molecular Formula: OPb Molecular Weight (g/mol): 223.20 MDL Number: MFCD00011164 InChI Key: YEXPOXQUZXUXJW-UHFFFAOYSA-N Synonym: lead monoxide,lead ii oxide,lead oxide pbo,massicot,massicotite,lead monooxide,lead protoxide,plumbous oxide,litharge pure,lead oxide yellow PubChem CID: 14827 SMILES: O=[Pb]
| PubChem CID | 14827 |
|---|---|
| CAS | 1317-36-8 |
| Molecular Weight (g/mol) | 223.20 |
| MDL Number | MFCD00011164 |
| SMILES | O=[Pb] |
| Synonym | lead monoxide,lead ii oxide,lead oxide pbo,massicot,massicotite,lead monooxide,lead protoxide,plumbous oxide,litharge pure,lead oxide yellow |
| InChI Key | YEXPOXQUZXUXJW-UHFFFAOYSA-N |
| Molecular Formula | OPb |
Sodium iodide dihydrate, 99+%, for analysis
CAS: 13517-06-1 Molecular Formula: INa·2H2O Molecular Weight (g/mol): 185.93 MDL Number: MFCD00149211 InChI Key: VEEIYHUOLCUPSA-UHFFFAOYSA-M Synonym: sodium iodide dihydrate,acmc-20ajo4,i.na.2h2o,sodium dihydrate iodide,sodium iodide-water 1/1/2,sodium iodide nai ,dihydrate 9ci PubChem CID: 23685997 IUPAC Name: sodium;iodide;dihydrate SMILES: O.O.[Na+].[I-]
| PubChem CID | 23685997 |
|---|---|
| CAS | 13517-06-1 |
| Molecular Weight (g/mol) | 185.93 |
| MDL Number | MFCD00149211 |
| SMILES | O.O.[Na+].[I-] |
| Synonym | sodium iodide dihydrate,acmc-20ajo4,i.na.2h2o,sodium dihydrate iodide,sodium iodide-water 1/1/2,sodium iodide nai ,dihydrate 9ci |
| IUPAC Name | sodium;iodide;dihydrate |
| InChI Key | VEEIYHUOLCUPSA-UHFFFAOYSA-M |
| Molecular Formula | INa·2H2O |
Sodium thiosulfate, 98.5%, extra pure, anhydrous
CAS: 7772-98-7 Molecular Formula: Na2O3S2 Molecular Weight (g/mol): 158.10 MDL Number: MFCD00003499 InChI Key: AKHNMLFCWUSKQB-UHFFFAOYSA-L Synonym: sodium thiosulfate,sodium thiosulphate,disodium thiosulfate,sodium thiosulfate anhydrous,hypo,sodiumthiosulfate,chlorine cure,chlorine control,declor-it,thiosulfuric acid, disodium salt PubChem CID: 24477 SMILES: [Na+].[Na+].[O-]S([S-])(=O)=O
| PubChem CID | 24477 |
|---|---|
| CAS | 7772-98-7 |
| Molecular Weight (g/mol) | 158.10 |
| MDL Number | MFCD00003499 |
| SMILES | [Na+].[Na+].[O-]S([S-])(=O)=O |
| Synonym | sodium thiosulfate,sodium thiosulphate,disodium thiosulfate,sodium thiosulfate anhydrous,hypo,sodiumthiosulfate,chlorine cure,chlorine control,declor-it,thiosulfuric acid, disodium salt |
| InChI Key | AKHNMLFCWUSKQB-UHFFFAOYSA-L |
| Molecular Formula | Na2O3S2 |
Nickel foil, 0.787mm (0.031in) thick, annealed, 99.5% (metals basis)
CAS: 7440-02-0 Molecular Formula: Ni Molecular Weight (g/mol): 58.69 MDL Number: MFCD00011137 MFCD06798735 InChI Key: PXHVJJICTQNCMI-UHFFFAOYSA-N Synonym: raney alloy,fibrex,catalyst,particles,fibrex p,nickel, elemental,nichel italian,nickel, soluble salts,carbonyl powder,niccolum PubChem CID: 935 ChEBI: CHEBI:28112 IUPAC Name: nickel SMILES: [Ni]
| PubChem CID | 935 |
|---|---|
| CAS | 7440-02-0 |
| Molecular Weight (g/mol) | 58.69 |
| ChEBI | CHEBI:28112 |
| MDL Number | MFCD00011137 MFCD06798735 |
| SMILES | [Ni] |
| Synonym | raney alloy,fibrex,catalyst,particles,fibrex p,nickel, elemental,nichel italian,nickel, soluble salts,carbonyl powder,niccolum |
| IUPAC Name | nickel |
| InChI Key | PXHVJJICTQNCMI-UHFFFAOYSA-N |
| Molecular Formula | Ni |
Sodium oxalate, ACS, 99.5+%
CAS: 62-76-0 Molecular Formula: C2Na2O4 Molecular Weight (g/mol): 134.00 MDL Number: MFCD00012465 InChI Key: ZNCPFRVNHGOPAG-UHFFFAOYSA-L Synonym: sodium oxalate,disodium oxalate,natriumoxalat,ethanedioic acid, disodium salt,oxalic acid, disodium salt,natriumoxalat german,stavelan sodny czech,oxalic acid disodium salt,unii-7u0v68lt9x,ethanedioic acid disodium salt PubChem CID: 6125 IUPAC Name: disodium;oxalate SMILES: [Na+].[Na+].[O-]C(=O)C([O-])=O
| PubChem CID | 6125 |
|---|---|
| CAS | 62-76-0 |
| Molecular Weight (g/mol) | 134.00 |
| MDL Number | MFCD00012465 |
| SMILES | [Na+].[Na+].[O-]C(=O)C([O-])=O |
| Synonym | sodium oxalate,disodium oxalate,natriumoxalat,ethanedioic acid, disodium salt,oxalic acid, disodium salt,natriumoxalat german,stavelan sodny czech,oxalic acid disodium salt,unii-7u0v68lt9x,ethanedioic acid disodium salt |
| IUPAC Name | disodium;oxalate |
| InChI Key | ZNCPFRVNHGOPAG-UHFFFAOYSA-L |
| Molecular Formula | C2Na2O4 |